C12H9NO6 — CID 154181112
2-(1,3-dioxoisoindol-2-yl)-3-methoxy-3-oxopropanoic acid (PubChem CID 154181112) has the molecular formula C12H9NO6 and a molecular weight of 263.20 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-3-methoxy-3-oxopropanoic acid.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-3-methoxy-3-oxopropanoic acid |
|---|---|
| PubChem CID | 154181112 |
| Molecular Formula | C12H9NO6 |
| Molecular Weight | 263.20 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-3-methoxy-3-oxopropanoic acid |
| SMILES | COC(=O)C(C(=O)O)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C12H9NO6/c1-19-12(18)8(11(16)17)13-9(14)6-4-2-3-5-7(6)10(13)15/h2-5,8H,1H3,(H,16,17) |
| InChIKey | WLSSVNSPSJJNFK-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.20 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|