C17H15NO4S — CID 102253584
methyl 2-[(1,3-dioxoisoindol-2-yl)methyl]-3-thiophen-2-ylpropanoate (PubChem CID 102253584) has the molecular formula C17H15NO4S and a molecular weight of 329.38 g/mol. Its IUPAC name is methyl 2-[(1,3-dioxoisoindol-2-yl)methyl]-3-thiophen-2-ylpropanoate.
| Compound Name | methyl 2-[(1,3-dioxoisoindol-2-yl)methyl]-3-thiophen-2-ylpropanoate |
|---|---|
| PubChem CID | 102253584 |
| Molecular Formula | C17H15NO4S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | methyl 2-[(1,3-dioxoisoindol-2-yl)methyl]-3-thiophen-2-ylpropanoate |
| SMILES | COC(=O)C(Cc1cccs1)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H15NO4S/c1-22-17(21)11(9-12-5-4-8-23-12)10-18-15(19)13-6-2-3-7-14(13)16(18)20/h2-8,11H,9-10H2,1H3 |
| InChIKey | BHWFYWHDSPNCNI-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|