C18H24O4S2 — CID 158347877
methyl 2-(thiophen-2-ylmethyl)butanoate;methyl 3-thiophen-2-ylpropanoate (PubChem CID 158347877) has the molecular formula C18H24O4S2 and a molecular weight of 368.52 g/mol. Its IUPAC name is methyl 2-(thiophen-2-ylmethyl)butanoate;methyl 3-thiophen-2-ylpropanoate.
| Compound Name | methyl 2-(thiophen-2-ylmethyl)butanoate;methyl 3-thiophen-2-ylpropanoate |
|---|---|
| PubChem CID | 158347877 |
| Molecular Formula | C18H24O4S2 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | methyl 2-(thiophen-2-ylmethyl)butanoate;methyl 3-thiophen-2-ylpropanoate |
| SMILES | CCC(Cc1cccs1)C(=O)OC.COC(=O)CCc1cccs1 |
| InChI | InChI=1S/C10H14O2S.C8H10O2S/c1-3-8(10(11)12-2)7-9-5-4-6-13-9;1-10-8(9)5-4-7-3-2-6-11-7/h4-6,8H,3,7H2,1-2H3;2-3,6H,4-5H2,1H3 |
| InChIKey | GRYKXRMJNSAVHU-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |