2-propanoyloxyethyl 3-oxo-5-thiophen-2-ylpentanoate

C14H18O5S — CID 174636106

IUPAC2-propanoyloxyethyl 3-oxo-5-thiophen-2-ylpentanoate
SMILESCCC(=O)OCCOC(=O)CC(=O)CCc1cccs1
InChIInChI=1S/C14H18O5S/c1-2-13(16)18-7-8-19-14(17)10-11(15)5-6-12-4-3-9-20-12/h3-4,9H,2,5-8,10H2,1H3
InChIKeyWZNYNEYSRRMPDA-UHFFFAOYSA-N
MW298.36 g/mol
LogP2.14
Rot. Bonds9

About 2-propanoyloxyethyl 3-oxo-5-thiophen-2-ylpentanoate

2-propanoyloxyethyl 3-oxo-5-thiophen-2-ylpentanoate (PubChem CID 174636106) has the molecular formula C14H18O5S and a molecular weight of 298.36 g/mol. Its IUPAC name is 2-propanoyloxyethyl 3-oxo-5-thiophen-2-ylpentanoate.

Molecular Properties

Compound Name2-propanoyloxyethyl 3-oxo-5-thiophen-2-ylpentanoate
PubChem CID174636106
Molecular FormulaC14H18O5S
Molecular Weight298.36 g/mol
Exact Mass298.09
IUPAC Name2-propanoyloxyethyl 3-oxo-5-thiophen-2-ylpentanoate
SMILESCCC(=O)OCCOC(=O)CC(=O)CCc1cccs1
InChIInChI=1S/C14H18O5S/c1-2-13(16)18-7-8-19-14(17)10-11(15)5-6-12-4-3-9-20-12/h3-4,9H,2,5-8,10H2,1H3
InChIKeyWZNYNEYSRRMPDA-UHFFFAOYSA-N
XLogP2.14
TPSA69.67 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds9
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500298.36
LogP ≤ 52.14
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 2-propanoyloxyethyl 3-oxo-5-thiophen-2-ylpentanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-propanoyloxyethyl 3-oxo-5-thiophen-2-ylpentanoate?
The IUPAC name of 2-propanoyloxyethyl 3-oxo-5-thiophen-2-ylpentanoate (CID 174636106) is 2-propanoyloxyethyl 3-oxo-5-thiophen-2-ylpentanoate.
What is the SMILES notation for 2-propanoyloxyethyl 3-oxo-5-thiophen-2-ylpentanoate?
The canonical SMILES for 2-propanoyloxyethyl 3-oxo-5-thiophen-2-ylpentanoate is CCC(=O)OCCOC(=O)CC(=O)CCc1cccs1.
What is the InChIKey of 2-propanoyloxyethyl 3-oxo-5-thiophen-2-ylpentanoate?
The InChIKey is WZNYNEYSRRMPDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O5S/c1-2-13(16)18-7-8-19-14(17)10-11(15)5-6-12-4-3-9-20-12/h3-4,9H,2,5-8,10H2,1H3.
What are the key properties of 2-propanoyloxyethyl 3-oxo-5-thiophen-2-ylpentanoate?
2-propanoyloxyethyl 3-oxo-5-thiophen-2-ylpentanoate has a molecular weight of 298.36 g/mol, XLogP of 2.14, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propanoyloxyethyl 3-oxo-5-thiophen-2-ylpentanoate is sourced from PubChem (CID 174636106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).