About 2-propanoyloxyethyl 3-oxo-5-thiophen-2-ylpentanoate
2-propanoyloxyethyl 3-oxo-5-thiophen-2-ylpentanoate (PubChem CID 174636106) has the molecular formula C14H18O5S
and a molecular weight of 298.36 g/mol. Its IUPAC name is 2-propanoyloxyethyl 3-oxo-5-thiophen-2-ylpentanoate.
Molecular Properties
| Compound Name | 2-propanoyloxyethyl 3-oxo-5-thiophen-2-ylpentanoate |
| PubChem CID | 174636106 |
| Molecular Formula | C14H18O5S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 2-propanoyloxyethyl 3-oxo-5-thiophen-2-ylpentanoate |
| SMILES | CCC(=O)OCCOC(=O)CC(=O)CCc1cccs1 |
| InChI | InChI=1S/C14H18O5S/c1-2-13(16)18-7-8-19-14(17)10-11(15)5-6-12-4-3-9-20-12/h3-4,9H,2,5-8,10H2,1H3 |
| InChIKey | WZNYNEYSRRMPDA-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-propanoyloxyethyl 3-oxo-5-thiophen-2-ylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propanoyloxyethyl 3-oxo-5-thiophen-2-ylpentanoate?
The IUPAC name of 2-propanoyloxyethyl 3-oxo-5-thiophen-2-ylpentanoate (CID 174636106) is 2-propanoyloxyethyl 3-oxo-5-thiophen-2-ylpentanoate.
What is the SMILES notation for 2-propanoyloxyethyl 3-oxo-5-thiophen-2-ylpentanoate?
The canonical SMILES for 2-propanoyloxyethyl 3-oxo-5-thiophen-2-ylpentanoate is CCC(=O)OCCOC(=O)CC(=O)CCc1cccs1.
What is the InChIKey of 2-propanoyloxyethyl 3-oxo-5-thiophen-2-ylpentanoate?
The InChIKey is WZNYNEYSRRMPDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O5S/c1-2-13(16)18-7-8-19-14(17)10-11(15)5-6-12-4-3-9-20-12/h3-4,9H,2,5-8,10H2,1H3.
What are the key properties of 2-propanoyloxyethyl 3-oxo-5-thiophen-2-ylpentanoate?
2-propanoyloxyethyl 3-oxo-5-thiophen-2-ylpentanoate has a molecular weight of 298.36 g/mol, XLogP of 2.14, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propanoyloxyethyl 3-oxo-5-thiophen-2-ylpentanoate is sourced from PubChem (CID 174636106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).