C8H12N2OS — CID 116846300
N'-methyl-3-thiophen-2-ylpropanehydrazide (PubChem CID 116846300) has the molecular formula C8H12N2OS and a molecular weight of 184.26 g/mol. Its IUPAC name is N'-methyl-3-thiophen-2-ylpropanehydrazide.
| Compound Name | N'-methyl-3-thiophen-2-ylpropanehydrazide |
|---|---|
| PubChem CID | 116846300 |
| Molecular Formula | C8H12N2OS |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | N'-methyl-3-thiophen-2-ylpropanehydrazide |
| SMILES | CNNC(=O)CCc1cccs1 |
| InChI | InChI=1S/C8H12N2OS/c1-9-10-8(11)5-4-7-3-2-6-12-7/h2-3,6,9H,4-5H2,1H3,(H,10,11) |
| InChIKey | PUKBLHJJIICVAA-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|