C14H14N2O2S — CID 30859496
N'-(3-thiophen-2-ylpropanoyl)benzohydrazide (PubChem CID 30859496) has the molecular formula C14H14N2O2S and a molecular weight of 274.35 g/mol. Its IUPAC name is N'-(3-thiophen-2-ylpropanoyl)benzohydrazide.
| Compound Name | N'-(3-thiophen-2-ylpropanoyl)benzohydrazide |
|---|---|
| PubChem CID | 30859496 |
| Molecular Formula | C14H14N2O2S |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | N'-(3-thiophen-2-ylpropanoyl)benzohydrazide |
| SMILES | O=C(CCc1cccs1)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C14H14N2O2S/c17-13(9-8-12-7-4-10-19-12)15-16-14(18)11-5-2-1-3-6-11/h1-7,10H,8-9H2,(H,15,17)(H,16,18) |
| InChIKey | HRZCBJCBPQMGFM-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|