C17H20N2O4S — CID 17391517
3,5-dimethoxy-N'-(4-thiophen-2-ylbutanoyl)benzohydrazide (PubChem CID 17391517) has the molecular formula C17H20N2O4S and a molecular weight of 348.42 g/mol. Its IUPAC name is 3,5-dimethoxy-N'-(4-thiophen-2-ylbutanoyl)benzohydrazide.
| Compound Name | 3,5-dimethoxy-N'-(4-thiophen-2-ylbutanoyl)benzohydrazide |
|---|---|
| PubChem CID | 17391517 |
| Molecular Formula | C17H20N2O4S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 3,5-dimethoxy-N'-(4-thiophen-2-ylbutanoyl)benzohydrazide |
| SMILES | COc1cc(OC)cc(C(=O)NNC(=O)CCCc2cccs2)c1 |
| InChI | InChI=1S/C17H20N2O4S/c1-22-13-9-12(10-14(11-13)23-2)17(21)19-18-16(20)7-3-5-15-6-4-8-24-15/h4,6,8-11H,3,5,7H2,1-2H3,(H,18,20)(H,19,21) |
| InChIKey | MMADYASYURXIOE-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|