C17H21NO3S — CID 111115545
N-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-4-thiophen-2-ylbutanamide (PubChem CID 111115545) has the molecular formula C17H21NO3S and a molecular weight of 319.43 g/mol. Its IUPAC name is N-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-4-thiophen-2-ylbutanamide.
| Compound Name | N-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-4-thiophen-2-ylbutanamide |
|---|---|
| PubChem CID | 111115545 |
| Molecular Formula | C17H21NO3S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | N-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-4-thiophen-2-ylbutanamide |
| SMILES | COc1cccc(C(O)CNC(=O)CCCc2cccs2)c1 |
| InChI | InChI=1S/C17H21NO3S/c1-21-14-6-2-5-13(11-14)16(19)12-18-17(20)9-3-7-15-8-4-10-22-15/h2,4-6,8,10-11,16,19H,3,7,9,12H2,1H3,(H,18,20) |
| InChIKey | FRDOOYJHBXGADM-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |