C12H18N2O3 — CID 119765490
N-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-2-(methylamino)acetamide (PubChem CID 119765490) has the molecular formula C12H18N2O3 and a molecular weight of 238.29 g/mol. Its IUPAC name is N-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-2-(methylamino)acetamide.
| Compound Name | N-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-2-(methylamino)acetamide |
|---|---|
| PubChem CID | 119765490 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | N-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-2-(methylamino)acetamide |
| SMILES | CNCC(=O)NCC(O)c1cccc(OC)c1 |
| InChI | InChI=1S/C12H18N2O3/c1-13-8-12(16)14-7-11(15)9-4-3-5-10(6-9)17-2/h3-6,11,13,15H,7-8H2,1-2H3,(H,14,16) |
| InChIKey | XJMUXRUHQRHNGU-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |