C19H23NO3 — CID 110663371
N-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-3-(2-methylphenyl)propanamide (PubChem CID 110663371) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is N-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-3-(2-methylphenyl)propanamide.
| Compound Name | N-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-3-(2-methylphenyl)propanamide |
|---|---|
| PubChem CID | 110663371 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | N-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-3-(2-methylphenyl)propanamide |
| SMILES | COc1cccc(C(O)CNC(=O)CCc2ccccc2C)c1 |
| InChI | InChI=1S/C19H23NO3/c1-14-6-3-4-7-15(14)10-11-19(22)20-13-18(21)16-8-5-9-17(12-16)23-2/h3-9,12,18,21H,10-11,13H2,1-2H3,(H,20,22) |
| InChIKey | FMVRXYRVPBAVHH-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |