C19H26N2O2S — CID 134057342
N-[2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]-4-thiophen-2-ylbutanamide (PubChem CID 134057342) has the molecular formula C19H26N2O2S and a molecular weight of 346.50 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]-4-thiophen-2-ylbutanamide.
| Compound Name | N-[2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]-4-thiophen-2-ylbutanamide |
|---|---|
| PubChem CID | 134057342 |
| Molecular Formula | C19H26N2O2S |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | N-[2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]-4-thiophen-2-ylbutanamide |
| SMILES | COc1cccc(C(CNC(=O)CCCc2cccs2)N(C)C)c1 |
| InChI | InChI=1S/C19H26N2O2S/c1-21(2)18(15-7-4-8-16(13-15)23-3)14-20-19(22)11-5-9-17-10-6-12-24-17/h4,6-8,10,12-13,18H,5,9,11,14H2,1-3H3,(H,20,22) |
| InChIKey | HGPILUMCFCLXKE-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |