C20H26N4O4S2 — CID 26011944
4-(4-methylpiperazin-1-yl)sulfonyl-N'-(4-thiophen-2-ylbutanoyl)benzohydrazide (PubChem CID 26011944) has the molecular formula C20H26N4O4S2 and a molecular weight of 450.59 g/mol. Its IUPAC name is 4-(4-methylpiperazin-1-yl)sulfonyl-N'-(4-thiophen-2-ylbutanoyl)benzohydrazide.
| Compound Name | 4-(4-methylpiperazin-1-yl)sulfonyl-N'-(4-thiophen-2-ylbutanoyl)benzohydrazide |
|---|---|
| PubChem CID | 26011944 |
| Molecular Formula | C20H26N4O4S2 |
| Molecular Weight | 450.59 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | 4-(4-methylpiperazin-1-yl)sulfonyl-N'-(4-thiophen-2-ylbutanoyl)benzohydrazide |
| SMILES | CN1CCN(S(=O)(=O)c2ccc(C(=O)NNC(=O)CCCc3cccs3)cc2)CC1 |
| InChI | InChI=1S/C20H26N4O4S2/c1-23-11-13-24(14-12-23)30(27,28)18-9-7-16(8-10-18)20(26)22-21-19(25)6-2-4-17-5-3-15-29-17/h3,5,7-10,15H,2,4,6,11-14H2,1H3,(H,21,25)(H,22,26) |
| InChIKey | SHDCPVPWSNHOIG-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.59 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|