C18H28N4O4S — CID 25478585
N'-(3,3-dimethylbutanoyl)-4-(4-methylpiperazin-1-yl)sulfonylbenzohydrazide (PubChem CID 25478585) has the molecular formula C18H28N4O4S and a molecular weight of 396.51 g/mol. Its IUPAC name is N'-(3,3-dimethylbutanoyl)-4-(4-methylpiperazin-1-yl)sulfonylbenzohydrazide.
| Compound Name | N'-(3,3-dimethylbutanoyl)-4-(4-methylpiperazin-1-yl)sulfonylbenzohydrazide |
|---|---|
| PubChem CID | 25478585 |
| Molecular Formula | C18H28N4O4S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | N'-(3,3-dimethylbutanoyl)-4-(4-methylpiperazin-1-yl)sulfonylbenzohydrazide |
| SMILES | CN1CCN(S(=O)(=O)c2ccc(C(=O)NNC(=O)CC(C)(C)C)cc2)CC1 |
| InChI | InChI=1S/C18H28N4O4S/c1-18(2,3)13-16(23)19-20-17(24)14-5-7-15(8-6-14)27(25,26)22-11-9-21(4)10-12-22/h5-8H,9-13H2,1-4H3,(H,19,23)(H,20,24) |
| InChIKey | HVRBTKFPQXFMMR-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|