C18H21N3O4S2 — CID 19258251
4-(4-formylpiperazin-1-yl)sulfonyl-N-(2-thiophen-2-ylethyl)benzamide (PubChem CID 19258251) has the molecular formula C18H21N3O4S2 and a molecular weight of 407.52 g/mol. Its IUPAC name is 4-(4-formylpiperazin-1-yl)sulfonyl-N-(2-thiophen-2-ylethyl)benzamide.
| Compound Name | 4-(4-formylpiperazin-1-yl)sulfonyl-N-(2-thiophen-2-ylethyl)benzamide |
|---|---|
| PubChem CID | 19258251 |
| Molecular Formula | C18H21N3O4S2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | 4-(4-formylpiperazin-1-yl)sulfonyl-N-(2-thiophen-2-ylethyl)benzamide |
| SMILES | O=CN1CCN(S(=O)(=O)c2ccc(C(=O)NCCc3cccs3)cc2)CC1 |
| InChI | InChI=1S/C18H21N3O4S2/c22-14-20-9-11-21(12-10-20)27(24,25)17-5-3-15(4-6-17)18(23)19-8-7-16-2-1-13-26-16/h1-6,13-14H,7-12H2,(H,19,23) |
| InChIKey | MBSNHTWTHBXKFP-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|