C19H26N3O3S2+ — CID 9036914
(2S)-2-[4-(benzenesulfonyl)piperazin-1-ium-1-yl]-N-(2-thiophen-2-ylethyl)propanamide (PubChem CID 9036914) has the molecular formula C19H26N3O3S2+ and a molecular weight of 408.57 g/mol. Its IUPAC name is (2S)-2-[4-(benzenesulfonyl)piperazin-1-ium-1-yl]-N-(2-thiophen-2-ylethyl)propanamide.
| Compound Name | (2S)-2-[4-(benzenesulfonyl)piperazin-1-ium-1-yl]-N-(2-thiophen-2-ylethyl)propanamide |
|---|---|
| PubChem CID | 9036914 |
| Molecular Formula | C19H26N3O3S2+ |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | (2S)-2-[4-(benzenesulfonyl)piperazin-1-ium-1-yl]-N-(2-thiophen-2-ylethyl)propanamide |
| SMILES | C[C@@H](C(=O)NCCc1cccs1)[NH+]1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C19H25N3O3S2/c1-16(19(23)20-10-9-17-6-5-15-26-17)21-11-13-22(14-12-21)27(24,25)18-7-3-2-4-8-18/h2-8,15-16H,9-14H2,1H3,(H,20,23)/p+1/t16-/m0/s1 |
| InChIKey | DFSJAZSBNBVKCW-INIZCTEOSA-O |
| XLogP | 0.38 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |