C20H27N3O4S2 — CID 40819018
(2R)-2-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]-N-(2-thiophen-2-ylethyl)propanamide (PubChem CID 40819018) has the molecular formula C20H27N3O4S2 and a molecular weight of 437.59 g/mol. Its IUPAC name is (2R)-2-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]-N-(2-thiophen-2-ylethyl)propanamide.
| Compound Name | (2R)-2-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]-N-(2-thiophen-2-ylethyl)propanamide |
|---|---|
| PubChem CID | 40819018 |
| Molecular Formula | C20H27N3O4S2 |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | (2R)-2-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]-N-(2-thiophen-2-ylethyl)propanamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCN([C@H](C)C(=O)NCCc3cccs3)CC2)cc1 |
| InChI | InChI=1S/C20H27N3O4S2/c1-16(20(24)21-10-9-18-4-3-15-28-18)22-11-13-23(14-12-22)29(25,26)19-7-5-17(27-2)6-8-19/h3-8,15-16H,9-14H2,1-2H3,(H,21,24)/t16-/m1/s1 |
| InChIKey | ILVABWJOEBDAEE-MRXNPFEDSA-N |
| XLogP | 1.81 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |