C25H29N3O4S — CID 166434953
N-[(4-methoxyphenyl)methyl]-2-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)propanamide (PubChem CID 166434953) has the molecular formula C25H29N3O4S and a molecular weight of 467.59 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methyl]-2-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)propanamide.
| Compound Name | N-[(4-methoxyphenyl)methyl]-2-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)propanamide |
|---|---|
| PubChem CID | 166434953 |
| Molecular Formula | C25H29N3O4S |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]-2-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)propanamide |
| SMILES | COc1ccc(CNC(=O)C(C)N2CCN(S(=O)(=O)c3ccc4ccccc4c3)CC2)cc1 |
| InChI | InChI=1S/C25H29N3O4S/c1-19(25(29)26-18-20-7-10-23(32-2)11-8-20)27-13-15-28(16-14-27)33(30,31)24-12-9-21-5-3-4-6-22(21)17-24/h3-12,17,19H,13-16,18H2,1-2H3,(H,26,29) |
| InChIKey | UCTAKYIWPPTBFY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |