C19H25ClN3OS+ — CID 9028505
(2S)-2-[4-(2-chlorophenyl)piperazin-1-ium-1-yl]-N-(2-thiophen-2-ylethyl)propanamide (PubChem CID 9028505) has the molecular formula C19H25ClN3OS+ and a molecular weight of 378.95 g/mol. Its IUPAC name is (2S)-2-[4-(2-chlorophenyl)piperazin-1-ium-1-yl]-N-(2-thiophen-2-ylethyl)propanamide.
| Compound Name | (2S)-2-[4-(2-chlorophenyl)piperazin-1-ium-1-yl]-N-(2-thiophen-2-ylethyl)propanamide |
|---|---|
| PubChem CID | 9028505 |
| Molecular Formula | C19H25ClN3OS+ |
| Molecular Weight | 378.95 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | (2S)-2-[4-(2-chlorophenyl)piperazin-1-ium-1-yl]-N-(2-thiophen-2-ylethyl)propanamide |
| SMILES | C[C@@H](C(=O)NCCc1cccs1)[NH+]1CCN(c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C19H24ClN3OS/c1-15(19(24)21-9-8-16-5-4-14-25-16)22-10-12-23(13-11-22)18-7-3-2-6-17(18)20/h2-7,14-15H,8-13H2,1H3,(H,21,24)/p+1/t15-/m0/s1 |
| InChIKey | UGAVFOHYPIPLNK-HNNXBMFYSA-O |
| XLogP | 1.85 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.95 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |