C17H24N4OS+2 — CID 9459411
(2R)-2-(4-pyridin-1-ium-2-ylpiperazin-1-ium-1-yl)-N-(thiophen-2-ylmethyl)propanamide (PubChem CID 9459411) has the molecular formula C17H24N4OS+2 and a molecular weight of 332.47 g/mol. Its IUPAC name is (2R)-2-(4-pyridin-1-ium-2-ylpiperazin-1-ium-1-yl)-N-(thiophen-2-ylmethyl)propanamide.
| Compound Name | (2R)-2-(4-pyridin-1-ium-2-ylpiperazin-1-ium-1-yl)-N-(thiophen-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 9459411 |
| Molecular Formula | C17H24N4OS+2 |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | (2R)-2-(4-pyridin-1-ium-2-ylpiperazin-1-ium-1-yl)-N-(thiophen-2-ylmethyl)propanamide |
| SMILES | C[C@H](C(=O)NCc1cccs1)[NH+]1CCN(c2cccc[nH+]2)CC1 |
| InChI | InChI=1S/C17H22N4OS/c1-14(17(22)19-13-15-5-4-12-23-15)20-8-10-21(11-9-20)16-6-2-3-7-18-16/h2-7,12,14H,8-11,13H2,1H3,(H,19,22)/p+2/t14-/m1/s1 |
| InChIKey | DPOZGBJWILOBEQ-CQSZACIVSA-P |
| XLogP | -0.03 |
| TPSA | 50.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |