C16H20N3OS+ — CID 7130488
6-piperidin-1-yl-N-(thiophen-2-ylmethyl)pyridin-1-ium-3-carboxamide (PubChem CID 7130488) has the molecular formula C16H20N3OS+ and a molecular weight of 302.42 g/mol. Its IUPAC name is 6-piperidin-1-yl-N-(thiophen-2-ylmethyl)pyridin-1-ium-3-carboxamide.
| Compound Name | 6-piperidin-1-yl-N-(thiophen-2-ylmethyl)pyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 7130488 |
| Molecular Formula | C16H20N3OS+ |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 6-piperidin-1-yl-N-(thiophen-2-ylmethyl)pyridin-1-ium-3-carboxamide |
| SMILES | O=C(NCc1cccs1)c1ccc(N2CCCCC2)[nH+]c1 |
| InChI | InChI=1S/C16H19N3OS/c20-16(18-12-14-5-4-10-21-14)13-6-7-15(17-11-13)19-8-2-1-3-9-19/h4-7,10-11H,1-3,8-9,12H2,(H,18,20)/p+1 |
| InChIKey | LIUPHHQGXMTTEM-UHFFFAOYSA-O |
| XLogP | 2.48 |
| TPSA | 46.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |