C15H19N3O4S — CID 109058274
N-cyclopropyl-4-(4-formylpiperazin-1-yl)sulfonylbenzamide (PubChem CID 109058274) has the molecular formula C15H19N3O4S and a molecular weight of 337.40 g/mol. Its IUPAC name is N-cyclopropyl-4-(4-formylpiperazin-1-yl)sulfonylbenzamide.
| Compound Name | N-cyclopropyl-4-(4-formylpiperazin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 109058274 |
| Molecular Formula | C15H19N3O4S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | N-cyclopropyl-4-(4-formylpiperazin-1-yl)sulfonylbenzamide |
| SMILES | O=CN1CCN(S(=O)(=O)c2ccc(C(=O)NC3CC3)cc2)CC1 |
| InChI | InChI=1S/C15H19N3O4S/c19-11-17-7-9-18(10-8-17)23(21,22)14-5-1-12(2-6-14)15(20)16-13-3-4-13/h1-2,5-6,11,13H,3-4,7-10H2,(H,16,20) |
| InChIKey | PLIFALJVIKXXMI-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|