C18H18BrFN2O3S — CID 35400948
N-[1-(4-bromophenyl)sulfonylpiperidin-4-yl]-4-fluorobenzamide (PubChem CID 35400948) has the molecular formula C18H18BrFN2O3S and a molecular weight of 441.32 g/mol. Its IUPAC name is N-[1-(4-bromophenyl)sulfonylpiperidin-4-yl]-4-fluorobenzamide.
| Compound Name | N-[1-(4-bromophenyl)sulfonylpiperidin-4-yl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 35400948 |
| Molecular Formula | C18H18BrFN2O3S |
| Molecular Weight | 441.32 g/mol |
| Exact Mass | 440.02 |
| IUPAC Name | N-[1-(4-bromophenyl)sulfonylpiperidin-4-yl]-4-fluorobenzamide |
| SMILES | O=C(NC1CCN(S(=O)(=O)c2ccc(Br)cc2)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H18BrFN2O3S/c19-14-3-7-17(8-4-14)26(24,25)22-11-9-16(10-12-22)21-18(23)13-1-5-15(20)6-2-13/h1-8,16H,9-12H2,(H,21,23) |
| InChIKey | RVMFWUBCDCFUCU-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.32 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |