C19H21FN2O3S — CID 3218791
N-[1-(4-fluorophenyl)sulfonylpiperidin-4-yl]-2-methylbenzamide (PubChem CID 3218791) has the molecular formula C19H21FN2O3S and a molecular weight of 376.45 g/mol. Its IUPAC name is N-[1-(4-fluorophenyl)sulfonylpiperidin-4-yl]-2-methylbenzamide.
| Compound Name | N-[1-(4-fluorophenyl)sulfonylpiperidin-4-yl]-2-methylbenzamide |
|---|---|
| PubChem CID | 3218791 |
| Molecular Formula | C19H21FN2O3S |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | N-[1-(4-fluorophenyl)sulfonylpiperidin-4-yl]-2-methylbenzamide |
| SMILES | Cc1ccccc1C(=O)NC1CCN(S(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C19H21FN2O3S/c1-14-4-2-3-5-18(14)19(23)21-16-10-12-22(13-11-16)26(24,25)17-8-6-15(20)7-9-17/h2-9,16H,10-13H2,1H3,(H,21,23) |
| InChIKey | IACUFWFPQTWIAA-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |