C14H12Cl2N2O2S — CID 27834779
2,5-dichloro-N'-(3-thiophen-2-ylpropanoyl)benzohydrazide (PubChem CID 27834779) has the molecular formula C14H12Cl2N2O2S and a molecular weight of 343.24 g/mol. Its IUPAC name is 2,5-dichloro-N'-(3-thiophen-2-ylpropanoyl)benzohydrazide.
| Compound Name | 2,5-dichloro-N'-(3-thiophen-2-ylpropanoyl)benzohydrazide |
|---|---|
| PubChem CID | 27834779 |
| Molecular Formula | C14H12Cl2N2O2S |
| Molecular Weight | 343.24 g/mol |
| Exact Mass | 342.00 |
| IUPAC Name | 2,5-dichloro-N'-(3-thiophen-2-ylpropanoyl)benzohydrazide |
| SMILES | O=C(CCc1cccs1)NNC(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H12Cl2N2O2S/c15-9-3-5-12(16)11(8-9)14(20)18-17-13(19)6-4-10-2-1-7-21-10/h1-3,5,7-8H,4,6H2,(H,17,19)(H,18,20) |
| InChIKey | FPZRPUQENAZUFX-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.24 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|