C14H13Cl2NOS2 — CID 46819854
2,5-dichloro-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]benzamide (PubChem CID 46819854) has the molecular formula C14H13Cl2NOS2 and a molecular weight of 346.30 g/mol. Its IUPAC name is 2,5-dichloro-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]benzamide.
| Compound Name | 2,5-dichloro-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]benzamide |
|---|---|
| PubChem CID | 46819854 |
| Molecular Formula | C14H13Cl2NOS2 |
| Molecular Weight | 346.30 g/mol |
| Exact Mass | 344.98 |
| IUPAC Name | 2,5-dichloro-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]benzamide |
| SMILES | O=C(NCCSCc1cccs1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H13Cl2NOS2/c15-10-3-4-13(16)12(8-10)14(18)17-5-7-19-9-11-2-1-6-20-11/h1-4,6,8H,5,7,9H2,(H,17,18) |
| InChIKey | COQVFVBEIVBZPC-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.30 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|