C15H15F2NO2S2 — CID 46516746
2-(difluoromethoxy)-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]benzamide (PubChem CID 46516746) has the molecular formula C15H15F2NO2S2 and a molecular weight of 343.42 g/mol. Its IUPAC name is 2-(difluoromethoxy)-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]benzamide.
| Compound Name | 2-(difluoromethoxy)-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]benzamide |
|---|---|
| PubChem CID | 46516746 |
| Molecular Formula | C15H15F2NO2S2 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | 2-(difluoromethoxy)-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]benzamide |
| SMILES | O=C(NCCSCc1cccs1)c1ccccc1OC(F)F |
| InChI | InChI=1S/C15H15F2NO2S2/c16-15(17)20-13-6-2-1-5-12(13)14(19)18-7-9-21-10-11-4-3-8-22-11/h1-6,8,15H,7,9-10H2,(H,18,19) |
| InChIKey | NHGFGHPGABQSPN-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|