C13H15NOS3 — CID 46516732
5-methyl-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]thiophene-2-carboxamide (PubChem CID 46516732) has the molecular formula C13H15NOS3 and a molecular weight of 297.47 g/mol. Its IUPAC name is 5-methyl-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]thiophene-2-carboxamide.
| Compound Name | 5-methyl-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 46516732 |
| Molecular Formula | C13H15NOS3 |
| Molecular Weight | 297.47 g/mol |
| Exact Mass | 297.03 |
| IUPAC Name | 5-methyl-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]thiophene-2-carboxamide |
| SMILES | Cc1ccc(C(=O)NCCSCc2cccs2)s1 |
| InChI | InChI=1S/C13H15NOS3/c1-10-4-5-12(18-10)13(15)14-6-8-16-9-11-3-2-7-17-11/h2-5,7H,6,8-9H2,1H3,(H,14,15) |
| InChIKey | BEEMGZINCOJBOY-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.47 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|