C17H19NO3S3 — CID 9060866
[2-oxo-2-[2-(thiophen-2-ylmethylsulfanyl)ethylamino]ethyl] (E)-3-(5-methylthiophen-2-yl)prop-2-enoate (PubChem CID 9060866) has the molecular formula C17H19NO3S3 and a molecular weight of 381.54 g/mol. Its IUPAC name is [2-oxo-2-[2-(thiophen-2-ylmethylsulfanyl)ethylamino]ethyl] (E)-3-(5-methylthiophen-2-yl)prop-2-enoate.
| Compound Name | [2-oxo-2-[2-(thiophen-2-ylmethylsulfanyl)ethylamino]ethyl] (E)-3-(5-methylthiophen-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 9060866 |
| Molecular Formula | C17H19NO3S3 |
| Molecular Weight | 381.54 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | [2-oxo-2-[2-(thiophen-2-ylmethylsulfanyl)ethylamino]ethyl] (E)-3-(5-methylthiophen-2-yl)prop-2-enoate |
| SMILES | Cc1ccc(/C=C/C(=O)OCC(=O)NCCSCc2cccs2)s1 |
| InChI | InChI=1S/C17H19NO3S3/c1-13-4-5-14(24-13)6-7-17(20)21-11-16(19)18-8-10-22-12-15-3-2-9-23-15/h2-7,9H,8,10-12H2,1H3,(H,18,19)/b7-6+ |
| InChIKey | GPTPVKLFNZLTJC-VOTSOKGWSA-N |
| XLogP | 3.72 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.54 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|