C17H19NO5S3 — CID 8955143
[2-oxo-2-[2-(thiophen-2-ylmethylsulfanyl)ethylamino]ethyl] 4-methylsulfonylbenzoate (PubChem CID 8955143) has the molecular formula C17H19NO5S3 and a molecular weight of 413.54 g/mol. Its IUPAC name is [2-oxo-2-[2-(thiophen-2-ylmethylsulfanyl)ethylamino]ethyl] 4-methylsulfonylbenzoate.
| Compound Name | [2-oxo-2-[2-(thiophen-2-ylmethylsulfanyl)ethylamino]ethyl] 4-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 8955143 |
| Molecular Formula | C17H19NO5S3 |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.04 |
| IUPAC Name | [2-oxo-2-[2-(thiophen-2-ylmethylsulfanyl)ethylamino]ethyl] 4-methylsulfonylbenzoate |
| SMILES | CS(=O)(=O)c1ccc(C(=O)OCC(=O)NCCSCc2cccs2)cc1 |
| InChI | InChI=1S/C17H19NO5S3/c1-26(21,22)15-6-4-13(5-7-15)17(20)23-11-16(19)18-8-10-24-12-14-3-2-9-25-14/h2-7,9H,8,10-12H2,1H3,(H,18,19) |
| InChIKey | HSMQBECNDFNGKG-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|