C21H21NO4S2 — CID 9066447
[2-oxo-2-[2-(thiophen-2-ylmethylsulfanyl)ethylamino]ethyl] 4-methoxynaphthalene-1-carboxylate (PubChem CID 9066447) has the molecular formula C21H21NO4S2 and a molecular weight of 415.54 g/mol. Its IUPAC name is [2-oxo-2-[2-(thiophen-2-ylmethylsulfanyl)ethylamino]ethyl] 4-methoxynaphthalene-1-carboxylate.
| Compound Name | [2-oxo-2-[2-(thiophen-2-ylmethylsulfanyl)ethylamino]ethyl] 4-methoxynaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 9066447 |
| Molecular Formula | C21H21NO4S2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | [2-oxo-2-[2-(thiophen-2-ylmethylsulfanyl)ethylamino]ethyl] 4-methoxynaphthalene-1-carboxylate |
| SMILES | COc1ccc(C(=O)OCC(=O)NCCSCc2cccs2)c2ccccc12 |
| InChI | InChI=1S/C21H21NO4S2/c1-25-19-9-8-18(16-6-2-3-7-17(16)19)21(24)26-13-20(23)22-10-12-27-14-15-5-4-11-28-15/h2-9,11H,10,12-14H2,1H3,(H,22,23) |
| InChIKey | JRELRHGLPWZHII-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|