C17H19NO5S — CID 7604434
[2-oxo-2-(2-thiophen-2-ylethylamino)ethyl] 2,4-dimethoxybenzoate (PubChem CID 7604434) has the molecular formula C17H19NO5S and a molecular weight of 349.41 g/mol. Its IUPAC name is [2-oxo-2-(2-thiophen-2-ylethylamino)ethyl] 2,4-dimethoxybenzoate.
| Compound Name | [2-oxo-2-(2-thiophen-2-ylethylamino)ethyl] 2,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 7604434 |
| Molecular Formula | C17H19NO5S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | [2-oxo-2-(2-thiophen-2-ylethylamino)ethyl] 2,4-dimethoxybenzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)NCCc2cccs2)c(OC)c1 |
| InChI | InChI=1S/C17H19NO5S/c1-21-12-5-6-14(15(10-12)22-2)17(20)23-11-16(19)18-8-7-13-4-3-9-24-13/h3-6,9-10H,7-8,11H2,1-2H3,(H,18,19) |
| InChIKey | FBMLUMYBBYHCTP-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |