C15H15FN2O3S — CID 24501401
[2-oxo-2-(2-thiophen-2-ylethylamino)ethyl] 2-amino-4-fluorobenzoate (PubChem CID 24501401) has the molecular formula C15H15FN2O3S and a molecular weight of 322.36 g/mol. Its IUPAC name is [2-oxo-2-(2-thiophen-2-ylethylamino)ethyl] 2-amino-4-fluorobenzoate.
| Compound Name | [2-oxo-2-(2-thiophen-2-ylethylamino)ethyl] 2-amino-4-fluorobenzoate |
|---|---|
| PubChem CID | 24501401 |
| Molecular Formula | C15H15FN2O3S |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | [2-oxo-2-(2-thiophen-2-ylethylamino)ethyl] 2-amino-4-fluorobenzoate |
| SMILES | Nc1cc(F)ccc1C(=O)OCC(=O)NCCc1cccs1 |
| InChI | InChI=1S/C15H15FN2O3S/c16-10-3-4-12(13(17)8-10)15(20)21-9-14(19)18-6-5-11-2-1-7-22-11/h1-4,7-8H,5-6,9,17H2,(H,18,19) |
| InChIKey | ZFLWYKLYWCLTTA-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|