C14H13N3O5S — CID 7148954
[2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2-amino-4-nitrobenzoate (PubChem CID 7148954) has the molecular formula C14H13N3O5S and a molecular weight of 335.34 g/mol. Its IUPAC name is [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2-amino-4-nitrobenzoate.
| Compound Name | [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2-amino-4-nitrobenzoate |
|---|---|
| PubChem CID | 7148954 |
| Molecular Formula | C14H13N3O5S |
| Molecular Weight | 335.34 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2-amino-4-nitrobenzoate |
| SMILES | Nc1cc([N+](=O)[O-])ccc1C(=O)OCC(=O)NCc1cccs1 |
| InChI | InChI=1S/C14H13N3O5S/c15-12-6-9(17(20)21)3-4-11(12)14(19)22-8-13(18)16-7-10-2-1-5-23-10/h1-6H,7-8,15H2,(H,16,18) |
| InChIKey | FBULAXIJCUVVQP-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.34 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|