C22H19N3O5 — CID 7149083
[2-(benzhydrylamino)-2-oxoethyl] 2-amino-4-nitrobenzoate (PubChem CID 7149083) has the molecular formula C22H19N3O5 and a molecular weight of 405.41 g/mol. Its IUPAC name is [2-(benzhydrylamino)-2-oxoethyl] 2-amino-4-nitrobenzoate.
| Compound Name | [2-(benzhydrylamino)-2-oxoethyl] 2-amino-4-nitrobenzoate |
|---|---|
| PubChem CID | 7149083 |
| Molecular Formula | C22H19N3O5 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | [2-(benzhydrylamino)-2-oxoethyl] 2-amino-4-nitrobenzoate |
| SMILES | Nc1cc([N+](=O)[O-])ccc1C(=O)OCC(=O)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H19N3O5/c23-19-13-17(25(28)29)11-12-18(19)22(27)30-14-20(26)24-21(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-13,21H,14,23H2,(H,24,26) |
| InChIKey | SOSGCEMESWWZKG-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|