C19H22N4O5 — CID 8808734
[2-[3-(N-methylanilino)propylamino]-2-oxoethyl] 2-amino-4-nitrobenzoate (PubChem CID 8808734) has the molecular formula C19H22N4O5 and a molecular weight of 386.41 g/mol. Its IUPAC name is [2-[3-(N-methylanilino)propylamino]-2-oxoethyl] 2-amino-4-nitrobenzoate.
| Compound Name | [2-[3-(N-methylanilino)propylamino]-2-oxoethyl] 2-amino-4-nitrobenzoate |
|---|---|
| PubChem CID | 8808734 |
| Molecular Formula | C19H22N4O5 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | [2-[3-(N-methylanilino)propylamino]-2-oxoethyl] 2-amino-4-nitrobenzoate |
| SMILES | CN(CCCNC(=O)COC(=O)c1ccc([N+](=O)[O-])cc1N)c1ccccc1 |
| InChI | InChI=1S/C19H22N4O5/c1-22(14-6-3-2-4-7-14)11-5-10-21-18(24)13-28-19(25)16-9-8-15(23(26)27)12-17(16)20/h2-4,6-9,12H,5,10-11,13,20H2,1H3,(H,21,24) |
| InChIKey | XJZWREHTHDHFNW-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 127.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|