C13H16N4O6 — CID 18085469
[2-oxo-2-(propylcarbamoylamino)ethyl] 2-amino-4-nitrobenzoate (PubChem CID 18085469) has the molecular formula C13H16N4O6 and a molecular weight of 324.29 g/mol. Its IUPAC name is [2-oxo-2-(propylcarbamoylamino)ethyl] 2-amino-4-nitrobenzoate.
| Compound Name | [2-oxo-2-(propylcarbamoylamino)ethyl] 2-amino-4-nitrobenzoate |
|---|---|
| PubChem CID | 18085469 |
| Molecular Formula | C13H16N4O6 |
| Molecular Weight | 324.29 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | [2-oxo-2-(propylcarbamoylamino)ethyl] 2-amino-4-nitrobenzoate |
| SMILES | CCCNC(=O)NC(=O)COC(=O)c1ccc([N+](=O)[O-])cc1N |
| InChI | InChI=1S/C13H16N4O6/c1-2-5-15-13(20)16-11(18)7-23-12(19)9-4-3-8(17(21)22)6-10(9)14/h3-4,6H,2,5,7,14H2,1H3,(H2,15,16,18,20) |
| InChIKey | SHRGOVASFBJETF-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 153.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.29 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|