C17H15ClN2O5 — CID 18073814
[2-oxo-2-(1-phenylethylamino)ethyl] 2-chloro-4-nitrobenzoate (PubChem CID 18073814) has the molecular formula C17H15ClN2O5 and a molecular weight of 362.77 g/mol. Its IUPAC name is [2-oxo-2-(1-phenylethylamino)ethyl] 2-chloro-4-nitrobenzoate.
| Compound Name | [2-oxo-2-(1-phenylethylamino)ethyl] 2-chloro-4-nitrobenzoate |
|---|---|
| PubChem CID | 18073814 |
| Molecular Formula | C17H15ClN2O5 |
| Molecular Weight | 362.77 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | [2-oxo-2-(1-phenylethylamino)ethyl] 2-chloro-4-nitrobenzoate |
| SMILES | CC(NC(=O)COC(=O)c1ccc([N+](=O)[O-])cc1Cl)c1ccccc1 |
| InChI | InChI=1S/C17H15ClN2O5/c1-11(12-5-3-2-4-6-12)19-16(21)10-25-17(22)14-8-7-13(20(23)24)9-15(14)18/h2-9,11H,10H2,1H3,(H,19,21) |
| InChIKey | GMKSWIWWTAHBEU-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.77 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|