C14H19NO6 — CID 2504659
[2-(2-methoxyethylamino)-2-oxoethyl] 2,4-dimethoxybenzoate (PubChem CID 2504659) has the molecular formula C14H19NO6 and a molecular weight of 297.31 g/mol. Its IUPAC name is [2-(2-methoxyethylamino)-2-oxoethyl] 2,4-dimethoxybenzoate.
| Compound Name | [2-(2-methoxyethylamino)-2-oxoethyl] 2,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 2504659 |
| Molecular Formula | C14H19NO6 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | [2-(2-methoxyethylamino)-2-oxoethyl] 2,4-dimethoxybenzoate |
| SMILES | COCCNC(=O)COC(=O)c1ccc(OC)cc1OC |
| InChI | InChI=1S/C14H19NO6/c1-18-7-6-15-13(16)9-21-14(17)11-5-4-10(19-2)8-12(11)20-3/h4-5,8H,6-7,9H2,1-3H3,(H,15,16) |
| InChIKey | YYHNQLMVGOFYMD-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|