C13H14F3NO5 — CID 2436819
[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 2,4-dimethoxybenzoate (PubChem CID 2436819) has the molecular formula C13H14F3NO5 and a molecular weight of 321.25 g/mol. Its IUPAC name is [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 2,4-dimethoxybenzoate.
| Compound Name | [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 2,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 2436819 |
| Molecular Formula | C13H14F3NO5 |
| Molecular Weight | 321.25 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 2,4-dimethoxybenzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)NCC(F)(F)F)c(OC)c1 |
| InChI | InChI=1S/C13H14F3NO5/c1-20-8-3-4-9(10(5-8)21-2)12(19)22-6-11(18)17-7-13(14,15)16/h3-5H,6-7H2,1-2H3,(H,17,18) |
| InChIKey | QYYVPIVBSWMRKS-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.25 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |