C16H17NO4S — CID 8866793
[2-oxo-2-(2-thiophen-2-ylethylamino)ethyl] 3-methoxybenzoate (PubChem CID 8866793) has the molecular formula C16H17NO4S and a molecular weight of 319.38 g/mol. Its IUPAC name is [2-oxo-2-(2-thiophen-2-ylethylamino)ethyl] 3-methoxybenzoate.
| Compound Name | [2-oxo-2-(2-thiophen-2-ylethylamino)ethyl] 3-methoxybenzoate |
|---|---|
| PubChem CID | 8866793 |
| Molecular Formula | C16H17NO4S |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | [2-oxo-2-(2-thiophen-2-ylethylamino)ethyl] 3-methoxybenzoate |
| SMILES | COc1cccc(C(=O)OCC(=O)NCCc2cccs2)c1 |
| InChI | InChI=1S/C16H17NO4S/c1-20-13-5-2-4-12(10-13)16(19)21-11-15(18)17-8-7-14-6-3-9-22-14/h2-6,9-10H,7-8,11H2,1H3,(H,17,18) |
| InChIKey | QKPOWXFTSBLECQ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |