C17H17F2NO5S — CID 8946943
[2-oxo-2-(2-thiophen-2-ylethylamino)ethyl] 4-(difluoromethoxy)-3-methoxybenzoate (PubChem CID 8946943) has the molecular formula C17H17F2NO5S and a molecular weight of 385.39 g/mol. Its IUPAC name is [2-oxo-2-(2-thiophen-2-ylethylamino)ethyl] 4-(difluoromethoxy)-3-methoxybenzoate.
| Compound Name | [2-oxo-2-(2-thiophen-2-ylethylamino)ethyl] 4-(difluoromethoxy)-3-methoxybenzoate |
|---|---|
| PubChem CID | 8946943 |
| Molecular Formula | C17H17F2NO5S |
| Molecular Weight | 385.39 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | [2-oxo-2-(2-thiophen-2-ylethylamino)ethyl] 4-(difluoromethoxy)-3-methoxybenzoate |
| SMILES | COc1cc(C(=O)OCC(=O)NCCc2cccs2)ccc1OC(F)F |
| InChI | InChI=1S/C17H17F2NO5S/c1-23-14-9-11(4-5-13(14)25-17(18)19)16(22)24-10-15(21)20-7-6-12-3-2-8-26-12/h2-5,8-9,17H,6-7,10H2,1H3,(H,20,21) |
| InChIKey | IHJHFWLGMCVARY-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.39 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |