C17H16F3NO3S2 — CID 8864901
[2-oxo-2-[2-(thiophen-2-ylmethylsulfanyl)ethylamino]ethyl] 3-(trifluoromethyl)benzoate (PubChem CID 8864901) has the molecular formula C17H16F3NO3S2 and a molecular weight of 403.45 g/mol. Its IUPAC name is [2-oxo-2-[2-(thiophen-2-ylmethylsulfanyl)ethylamino]ethyl] 3-(trifluoromethyl)benzoate.
| Compound Name | [2-oxo-2-[2-(thiophen-2-ylmethylsulfanyl)ethylamino]ethyl] 3-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 8864901 |
| Molecular Formula | C17H16F3NO3S2 |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.05 |
| IUPAC Name | [2-oxo-2-[2-(thiophen-2-ylmethylsulfanyl)ethylamino]ethyl] 3-(trifluoromethyl)benzoate |
| SMILES | O=C(COC(=O)c1cccc(C(F)(F)F)c1)NCCSCc1cccs1 |
| InChI | InChI=1S/C17H16F3NO3S2/c18-17(19,20)13-4-1-3-12(9-13)16(23)24-10-15(22)21-6-8-25-11-14-5-2-7-26-14/h1-5,7,9H,6,8,10-11H2,(H,21,22) |
| InChIKey | HPNYSXSMMFJYNP-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|