C16H16F3NOS — CID 174746651
N-(4-thiophen-2-ylbutyl)-3-(trifluoromethyl)benzamide (PubChem CID 174746651) has the molecular formula C16H16F3NOS and a molecular weight of 327.37 g/mol. Its IUPAC name is N-(4-thiophen-2-ylbutyl)-3-(trifluoromethyl)benzamide.
| Compound Name | N-(4-thiophen-2-ylbutyl)-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 174746651 |
| Molecular Formula | C16H16F3NOS |
| Molecular Weight | 327.37 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | N-(4-thiophen-2-ylbutyl)-3-(trifluoromethyl)benzamide |
| SMILES | O=C(NCCCCc1cccs1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H16F3NOS/c17-16(18,19)13-6-3-5-12(11-13)15(21)20-9-2-1-7-14-8-4-10-22-14/h3-6,8,10-11H,1-2,7,9H2,(H,20,21) |
| InChIKey | MUDOJYSQODIGEA-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.37 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|