C18H17F4NO2 — CID 55454553
N-[4-(4-fluorophenoxy)butyl]-3-(trifluoromethyl)benzamide (PubChem CID 55454553) has the molecular formula C18H17F4NO2 and a molecular weight of 355.33 g/mol. Its IUPAC name is N-[4-(4-fluorophenoxy)butyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[4-(4-fluorophenoxy)butyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 55454553 |
| Molecular Formula | C18H17F4NO2 |
| Molecular Weight | 355.33 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | N-[4-(4-fluorophenoxy)butyl]-3-(trifluoromethyl)benzamide |
| SMILES | O=C(NCCCCOc1ccc(F)cc1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H17F4NO2/c19-15-6-8-16(9-7-15)25-11-2-1-10-23-17(24)13-4-3-5-14(12-13)18(20,21)22/h3-9,12H,1-2,10-11H2,(H,23,24) |
| InChIKey | INRVAKXVZCTFBJ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.33 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|