C24H21ClN2O2S2 — CID 175218271
3-[3-(3-chlorophenyl)-2-oxo-1,3-thiazol-4-yl]-N-(4-thiophen-2-ylbutyl)benzamide (PubChem CID 175218271) has the molecular formula C24H21ClN2O2S2 and a molecular weight of 469.03 g/mol. Its IUPAC name is 3-[3-(3-chlorophenyl)-2-oxo-1,3-thiazol-4-yl]-N-(4-thiophen-2-ylbutyl)benzamide.
| Compound Name | 3-[3-(3-chlorophenyl)-2-oxo-1,3-thiazol-4-yl]-N-(4-thiophen-2-ylbutyl)benzamide |
|---|---|
| PubChem CID | 175218271 |
| Molecular Formula | C24H21ClN2O2S2 |
| Molecular Weight | 469.03 g/mol |
| Exact Mass | 468.07 |
| IUPAC Name | 3-[3-(3-chlorophenyl)-2-oxo-1,3-thiazol-4-yl]-N-(4-thiophen-2-ylbutyl)benzamide |
| SMILES | O=C(NCCCCc1cccs1)c1cccc(-c2csc(=O)n2-c2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C24H21ClN2O2S2/c25-19-8-4-9-20(15-19)27-22(16-31-24(27)29)17-6-3-7-18(14-17)23(28)26-12-2-1-10-21-11-5-13-30-21/h3-9,11,13-16H,1-2,10,12H2,(H,26,28) |
| InChIKey | WWUMWEUDWRKFMP-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.03 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|