C25H21FN2O3S2 — CID 175369785
3-[3-(5-fluoro-2-methoxyphenyl)-2-oxo-1,3-thiazol-4-yl]-N-[(E)-4-thiophen-2-ylbut-3-enyl]benzamide (PubChem CID 175369785) has the molecular formula C25H21FN2O3S2 and a molecular weight of 480.59 g/mol. Its IUPAC name is 3-[3-(5-fluoro-2-methoxyphenyl)-2-oxo-1,3-thiazol-4-yl]-N-[(E)-4-thiophen-2-ylbut-3-enyl]benzamide.
| Compound Name | 3-[3-(5-fluoro-2-methoxyphenyl)-2-oxo-1,3-thiazol-4-yl]-N-[(E)-4-thiophen-2-ylbut-3-enyl]benzamide |
|---|---|
| PubChem CID | 175369785 |
| Molecular Formula | C25H21FN2O3S2 |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.10 |
| IUPAC Name | 3-[3-(5-fluoro-2-methoxyphenyl)-2-oxo-1,3-thiazol-4-yl]-N-[(E)-4-thiophen-2-ylbut-3-enyl]benzamide |
| SMILES | COc1ccc(F)cc1-n1c(-c2cccc(C(=O)NCC/C=C/c3cccs3)c2)csc1=O |
| InChI | InChI=1S/C25H21FN2O3S2/c1-31-23-11-10-19(26)15-21(23)28-22(16-33-25(28)30)17-6-4-7-18(14-17)24(29)27-12-3-2-8-20-9-5-13-32-20/h2,4-11,13-16H,3,12H2,1H3,(H,27,29)/b8-2+ |
| InChIKey | QWMOLOUXNWECEE-KRXBUXKQSA-N |
| XLogP | 5.61 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|