About [4-fluoro-2-(3-thiophen-2-ylprop-2-enoyl)phenyl] 3,4-dimethoxybenzoate
[4-fluoro-2-(3-thiophen-2-ylprop-2-enoyl)phenyl] 3,4-dimethoxybenzoate (PubChem CID 2917544) has the molecular formula C22H17FO5S
and a molecular weight of 412.44 g/mol. Its IUPAC name is [4-fluoro-2-(3-thiophen-2-ylprop-2-enoyl)phenyl] 3,4-dimethoxybenzoate.
Molecular Properties
| Compound Name | [4-fluoro-2-(3-thiophen-2-ylprop-2-enoyl)phenyl] 3,4-dimethoxybenzoate |
| PubChem CID | 2917544 |
| Molecular Formula | C22H17FO5S |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | [4-fluoro-2-(3-thiophen-2-ylprop-2-enoyl)phenyl] 3,4-dimethoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccc(F)cc2C(=O)C=Cc2cccs2)cc1OC |
| InChI | InChI=1S/C22H17FO5S/c1-26-20-9-5-14(12-21(20)27-2)22(25)28-19-10-6-15(23)13-17(19)18(24)8-7-16-4-3-11-29-16/h3-13H,1-2H3 |
| InChIKey | AMIJWHBSNVOJKD-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-fluoro-2-(3-thiophen-2-ylprop-2-enoyl)phenyl] 3,4-dimethoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-fluoro-2-(3-thiophen-2-ylprop-2-enoyl)phenyl] 3,4-dimethoxybenzoate?
The IUPAC name of [4-fluoro-2-(3-thiophen-2-ylprop-2-enoyl)phenyl] 3,4-dimethoxybenzoate (CID 2917544) is [4-fluoro-2-(3-thiophen-2-ylprop-2-enoyl)phenyl] 3,4-dimethoxybenzoate.
What is the SMILES notation for [4-fluoro-2-(3-thiophen-2-ylprop-2-enoyl)phenyl] 3,4-dimethoxybenzoate?
The canonical SMILES for [4-fluoro-2-(3-thiophen-2-ylprop-2-enoyl)phenyl] 3,4-dimethoxybenzoate is COc1ccc(C(=O)Oc2ccc(F)cc2C(=O)C=Cc2cccs2)cc1OC.
What is the InChIKey of [4-fluoro-2-(3-thiophen-2-ylprop-2-enoyl)phenyl] 3,4-dimethoxybenzoate?
The InChIKey is AMIJWHBSNVOJKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17FO5S/c1-26-20-9-5-14(12-21(20)27-2)22(25)28-19-10-6-15(23)13-17(19)18(24)8-7-16-4-3-11-29-16/h3-13H,1-2H3.
What are the key properties of [4-fluoro-2-(3-thiophen-2-ylprop-2-enoyl)phenyl] 3,4-dimethoxybenzoate?
[4-fluoro-2-(3-thiophen-2-ylprop-2-enoyl)phenyl] 3,4-dimethoxybenzoate has a molecular weight of 412.44 g/mol, XLogP of 5.02, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-fluoro-2-(3-thiophen-2-ylprop-2-enoyl)phenyl] 3,4-dimethoxybenzoate is sourced from PubChem (CID 2917544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).