C25H21FO6 — CID 5108538
[2-[3-(3,4-dimethoxyphenyl)prop-2-enoyl]-4-fluorophenyl] 4-methoxybenzoate (PubChem CID 5108538) has the molecular formula C25H21FO6 and a molecular weight of 436.44 g/mol. Its IUPAC name is [2-[3-(3,4-dimethoxyphenyl)prop-2-enoyl]-4-fluorophenyl] 4-methoxybenzoate.
| Compound Name | [2-[3-(3,4-dimethoxyphenyl)prop-2-enoyl]-4-fluorophenyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 5108538 |
| Molecular Formula | C25H21FO6 |
| Molecular Weight | 436.44 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | [2-[3-(3,4-dimethoxyphenyl)prop-2-enoyl]-4-fluorophenyl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccc(F)cc2C(=O)C=Cc2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C25H21FO6/c1-29-19-9-6-17(7-10-19)25(28)32-22-13-8-18(26)15-20(22)21(27)11-4-16-5-12-23(30-2)24(14-16)31-3/h4-15H,1-3H3 |
| InChIKey | GMTBAMFJVQMOIG-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.44 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|