C24H19FNO7- — CID 163182263
[2-[3-(3,4-dimethoxyphenyl)prop-2-enoyl]-4-fluorophenyl] 4-[hydroxy(oxido)amino]benzoate (PubChem CID 163182263) has the molecular formula C24H19FNO7- and a molecular weight of 452.41 g/mol. Its IUPAC name is [2-[3-(3,4-dimethoxyphenyl)prop-2-enoyl]-4-fluorophenyl] 4-[hydroxy(oxido)amino]benzoate.
| Compound Name | [2-[3-(3,4-dimethoxyphenyl)prop-2-enoyl]-4-fluorophenyl] 4-[hydroxy(oxido)amino]benzoate |
|---|---|
| PubChem CID | 163182263 |
| Molecular Formula | C24H19FNO7- |
| Molecular Weight | 452.41 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | [2-[3-(3,4-dimethoxyphenyl)prop-2-enoyl]-4-fluorophenyl] 4-[hydroxy(oxido)amino]benzoate |
| SMILES | COc1ccc(C=CC(=O)c2cc(F)ccc2OC(=O)c2ccc(N([O-])O)cc2)cc1OC |
| InChI | InChI=1S/C24H19FNO7/c1-31-22-11-4-15(13-23(22)32-2)3-10-20(27)19-14-17(25)7-12-21(19)33-24(28)16-5-8-18(9-6-16)26(29)30/h3-14,29H,1-2H3/q-1 |
| InChIKey | HFWXIMTVSUYPKE-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.41 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|