C26H24O7 — CID 6124819
[2-methoxy-4-[(E)-3-(4-methoxyphenyl)-3-oxoprop-1-enyl]phenyl] 2,6-dimethoxybenzoate (PubChem CID 6124819) has the molecular formula C26H24O7 and a molecular weight of 448.47 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-3-(4-methoxyphenyl)-3-oxoprop-1-enyl]phenyl] 2,6-dimethoxybenzoate.
| Compound Name | [2-methoxy-4-[(E)-3-(4-methoxyphenyl)-3-oxoprop-1-enyl]phenyl] 2,6-dimethoxybenzoate |
|---|---|
| PubChem CID | 6124819 |
| Molecular Formula | C26H24O7 |
| Molecular Weight | 448.47 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | [2-methoxy-4-[(E)-3-(4-methoxyphenyl)-3-oxoprop-1-enyl]phenyl] 2,6-dimethoxybenzoate |
| SMILES | COc1ccc(C(=O)/C=C/c2ccc(OC(=O)c3c(OC)cccc3OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C26H24O7/c1-29-19-12-10-18(11-13-19)20(27)14-8-17-9-15-21(24(16-17)32-4)33-26(28)25-22(30-2)6-5-7-23(25)31-3/h5-16H,1-4H3/b14-8+ |
| InChIKey | XGEWHZJUAXSKRH-RIYZIHGNSA-N |
| XLogP | 4.84 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.47 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|